4-tert-butyl-2,2,6-trimethylhept-5-en-3-one structure
|
Common Name | 4-tert-butyl-2,2,6-trimethylhept-5-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 88036-43-5 | Molecular Weight | 210.35600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-2,2,6-trimethylhept-5-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H26O |
|---|---|
| Molecular Weight | 210.35600 |
| Exact Mass | 210.19800 |
| PSA | 17.07000 |
| LogP | 4.23010 |
| InChIKey | FNGSPMZWSBICMI-UHFFFAOYSA-N |
| SMILES | CC(C)=CC(C(=O)C(C)(C)C)C(C)(C)C |
|
~85%
4-tert-butyl-2,... CAS#:88036-43-5 |
| Literature: Wolff,S.; Agosta,W.C. Journal of the American Chemical Society, 1984 , vol. 106, p. 2363 |
|
~5%
4-tert-butyl-2,... CAS#:88036-43-5
Detail
|
| Literature: Wolff,S.; Agosta,W.C. Journal of the American Chemical Society, 1984 , vol. 106, p. 2363 |
|
~83%
4-tert-butyl-2,... CAS#:88036-43-5 |
| Literature: Wolff,S.; Agosta,W.C. Journal of the American Chemical Society, 1984 , vol. 106, p. 2363 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-tert-butyl-2,2,6-trimethyl-5-hepten-3-one |