2-(2-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid
Modify Date: 2025-11-26 12:32:30
2-(2-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid structure
|
Common Name | 2-(2-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 879070-37-8 | Molecular Weight | 237.25000 | |
| Density | 1.392g/cm3 | Boiling Point | 424.6ºC at 760 mmHg | |
| Molecular Formula | C11H8FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.6ºC | |
| Name | 2-(2-fluorophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 424.6ºC at 760 mmHg |
| Molecular Formula | C11H8FNO2S |
| Molecular Weight | 237.25000 |
| Flash Point | 210.6ºC |
| Exact Mass | 237.02600 |
| PSA | 78.43000 |
| LogP | 2.95580 |
| Index of Refraction | 1.609 |
| InChIKey | ZNAHNFKZFMHFQE-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccccc2F)sc1C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| bb_sc-5122 |