[but-2-enyl(pent-4-enoyl)amino] acetate
Modify Date: 2025-08-26 07:10:06
![[but-2-enyl(pent-4-enoyl)amino] acetate Structure](https://image.chemsrc.com/caspic/265/87842-84-0.png)
[but-2-enyl(pent-4-enoyl)amino] acetate structure
|
Common Name | [but-2-enyl(pent-4-enoyl)amino] acetate | ||
|---|---|---|---|---|
| CAS Number | 87842-84-0 | Molecular Weight | 211.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [but-2-enyl(pent-4-enoyl)amino] acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H17NO3 |
|---|---|
| Molecular Weight | 211.25800 |
| Exact Mass | 211.12100 |
| PSA | 46.61000 |
| LogP | 1.83540 |
| InChIKey | JSHIOLXGOOGMTO-UHFFFAOYSA-N |
| SMILES | C=CCCC(=O)N(CC=CC)OC(C)=O |
|
~86%
[but-2-enyl(pen... CAS#:87842-84-0 |
| Literature: Cheng,Y.S.; Lupo,A.T.; Fowler,F.W. Journal of the American Chemical Society, 1983 , vol. 105, p. 7696 |
|
~%
[but-2-enyl(pen... CAS#:87842-84-0 |
| Literature: Cheng,Y.S.; Lupo,A.T.; Fowler,F.W. Journal of the American Chemical Society, 1983 , vol. 105, p. 7696 |
![[acetyl(but-2-enyl)amino] acetate structure](https://image.chemsrc.com/caspic/227/87842-85-1.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| O-acetyl-N-2-butenyl-N-4-pentenoylhydroxylamine |