3-(3,5-diphenyl-1H-pyrrol-2-yl)-1-phenylbutan-1-one
Modify Date: 2025-12-06 07:30:09
3-(3,5-diphenyl-1H-pyrrol-2-yl)-1-phenylbutan-1-one structure
|
Common Name | 3-(3,5-diphenyl-1H-pyrrol-2-yl)-1-phenylbutan-1-one | ||
|---|---|---|---|---|
| CAS Number | 87803-44-9 | Molecular Weight | 365.46700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(3,5-diphenyl-1H-pyrrol-2-yl)-1-phenylbutan-1-one |
|---|
| Molecular Formula | C26H23NO |
|---|---|
| Molecular Weight | 365.46700 |
| Exact Mass | 365.17800 |
| PSA | 32.86000 |
| LogP | 6.72520 |
| InChIKey | MNAVUVQIUUOQBF-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)c1ccccc1)c1[nH]c(-c2ccccc2)cc1-c1ccccc1 |
|
~%
3-(3,5-diphenyl... CAS#:87803-44-9 |
| Literature: Katritzky, Alan R.; Rubio, Olga Journal of Organic Chemistry, 1984 , vol. 49, # 3 p. 448 - 454 |
|
~%
3-(3,5-diphenyl... CAS#:87803-44-9 |
| Literature: Katritzky, Alan R.; Rubio, Olga Journal of Organic Chemistry, 1984 , vol. 49, # 3 p. 448 - 454 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |