Dansyl-Ala-Arg-OH trifluoroacetate salt structure
|
Common Name | Dansyl-Ala-Arg-OH trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 87687-46-5 | Molecular Weight | 478.56500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30N6O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Dansyl-Ala-Arg-OH trifluoroacetate saltDansyl-Ala-Arg is a synthetic peptide. Dansyl-Ala-Arg can be used for various biochemical studies[1]. |
| Name | L-Arginine, N2-[N-[[5-(dimethylamino)-1-naphthalenyl]sulfonyl]-L-alanyl] |
|---|---|
| Synonym | More Synonyms |
| Description | Dansyl-Ala-Arg is a synthetic peptide. Dansyl-Ala-Arg can be used for various biochemical studies[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H30N6O5S |
|---|---|
| Molecular Weight | 478.56500 |
| Exact Mass | 478.20000 |
| PSA | 186.09000 |
| LogP | 3.45880 |
| InChIKey | LVOTWRDWOWKVRZ-LINSIKMZSA-N |
| SMILES | CC(NS(=O)(=O)c1cccc2c(N(C)C)cccc12)C(=O)NC(CCCN=C(N)N)C(=O)O.O=C(O)C(F)(F)F |
| dansyl-ala-arg-oh |