Dimethyl lithospermate B structure
|
Common Name | Dimethyl lithospermate B | ||
|---|---|---|---|---|
| CAS Number | 875313-64-7 | Molecular Weight | 746.667 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 968.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C38H34O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.5±27.8 °C | |
Use of Dimethyl lithospermate BDimethyl lithospermate B (dmLSB) is a selective Na+ channel agonist. Dimethyl lithospermate B slows inactivation of sodium current (INa), leading to increased inward current during the early phases of the action potential (AP)[1][2]. |
| Name | (2R)-3-(3,4-Dihydroxyphenyl)-1-methoxy-1-oxo-2-propanyl (2R,3R)-2-(3,4-dihydroxyphenyl)-4-[(1E)-3-{[(2R)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxo-2-propanyl]oxy}-3-oxo-1-propen-1-yl]-7-hydroxy-2,3-dihydro-1-benzofuran-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | Dimethyl lithospermate B (dmLSB) is a selective Na+ channel agonist. Dimethyl lithospermate B slows inactivation of sodium current (INa), leading to increased inward current during the early phases of the action potential (AP)[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Na+ channel[1] |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 968.3±65.0 °C at 760 mmHg |
| Molecular Formula | C38H34O16 |
| Molecular Weight | 746.667 |
| Flash Point | 300.5±27.8 °C |
| Exact Mass | 746.184692 |
| LogP | 2.98 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | DHYLGBJCEGEBGQ-QIBPRZLVSA-N |
| SMILES | COC(=O)C(Cc1ccc(O)c(O)c1)OC(=O)C=Cc1ccc(O)c2c1C(C(=O)OC(Cc1ccc(O)c(O)c1)C(=O)OC)C(c1ccc(O)c(O)c1)O2 |
| 3-Benzofurancarboxylic acid, 2-(3,4-dihydroxyphenyl)-4-[(1E)-3-[(1R)-1-[(3,4-dihydroxyphenyl)methyl]-2-methoxy-2-oxoethoxy]-3-oxo-1-propen-1-yl]-2,3-dihydro-7-hydroxy-, (1R)-1-[(3,4-dihydroxyphenyl)methyl]-2-methoxy-2-oxoethyl ester, (2R,3R)- |
| (2R)-3-(3,4-Dihydroxyphenyl)-1-methoxy-1-oxo-2-propanyl (2R,3R)-2-(3,4-dihydroxyphenyl)-4-[(1E)-3-{[(2R)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxo-2-propanyl]oxy}-3-oxo-1-propen-1-yl]-7-hydroxy-2,3-dihydro-1-benzofuran-3-carboxylate |
| Dimethyl lithospermate B |