2,4-Di-tert-butyl-5-nitrophenyl methyl carbonate structure
|
Common Name | 2,4-Di-tert-butyl-5-nitrophenyl methyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 873055-55-1 | Molecular Weight | 309.358 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 383.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7±29.9 °C | |
| Name | 2,4-Di-tert-butyl-5-nitrophenyl methyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.5±42.0 °C at 760 mmHg |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.358 |
| Flash Point | 134.7±29.9 °C |
| Exact Mass | 309.157623 |
| PSA | 81.35000 |
| LogP | 5.01 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | QBDLLAFFRJOLHZ-UHFFFAOYSA-N |
| SMILES | COC(=O)Oc1cc([N+](=O)[O-])c(C(C)(C)C)cc1C(C)(C)C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2920909090 |
|
~%
2,4-Di-tert-but... CAS#:873055-55-1 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED Patent: US2008/90864 A1, 2008 ; Location in patent: Page/Page column 7; 8 ; |
|
~%
2,4-Di-tert-but... CAS#:873055-55-1 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED; DEMATTEI, John; LOOKER, Adam, R.; NEUBERT-LANGILLE, Bobbianna; TRUDEAU, Martin; ROEPER, Stefanie; RYAN, Michael, P.; YAP, Dahrika, Milfred Lao; KRUEGER, Brian, R.; GROOTENHUIS, Peter, D.J.; VAN GOOR, Frederick, F.; BOTFIELD, Martyn, C.; ZLOKARNIK, Gregor Patent: WO2010/108162 A1, 2010 ; Location in patent: Page/Page column 86-88 ; |
|
~%
2,4-Di-tert-but... CAS#:873055-55-1 |
| Literature: Vertex Pharmaceuticals Incorported Patent: US2011/98311 A1, 2011 ; |
|
~%
2,4-Di-tert-but... CAS#:873055-55-1 |
| Literature: Vertex Pharmaceuticals Incorporated Patent: US2011/230519 A1, 2011 ; |
|
~%
2,4-Di-tert-but... CAS#:873055-55-1 |
| Literature: Vertex Pharmaceuticals Incorported Patent: US2011/98311 A1, 2011 ; |
| Precursor 3 | |
|---|---|
| DownStream 5 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (2,4-ditert-butyl-5-nitrophenyl) methyl carbonate |