NVP-QAV680 structure
|
Common Name | NVP-QAV680 | ||
|---|---|---|---|---|
| CAS Number | 872365-16-7 | Molecular Weight | 358.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of NVP-QAV680NVP-QAV680 is a potent and selective CRTh2 receptor antagonist suitable for clinical testing in allergic diseases. |
| Name | 2-[2-methyl-1-[(4-methylsulfonylphenyl)methyl]pyrrolo[2,3-b]pyridin-3-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18N2O4S |
|---|---|
| Molecular Weight | 358.41200 |
| Exact Mass | 358.09900 |
| PSA | 97.64000 |
| LogP | 3.50440 |
| InChIKey | YOPFAMROKXHVCQ-UHFFFAOYSA-N |
| SMILES | Cc1c(CC(=O)O)c2cccnc2n1Cc1ccc(S(C)(=O)=O)cc1 |
| UNII-0E3D72URPD |
| NVP-QAV680 |
| QAV690 free acid |