SPA-S 510 structure
|
Common Name | SPA-S 510 | ||
|---|---|---|---|---|
| CAS Number | 87234-24-0 | Molecular Weight | 461.490 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H19N3O5S | Melting Point | 261ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of SPA-S 510Piroxicam cinnamate (Cinnoxicam) is a cyclooxygenase (COX) inhibitor, with anti-inflammatory activity. Piroxicam cinnamate is stable under gastric conditions, can be used for inflammatory-degenerative osteoarticular diseases, rheumatic disorders, and varicocele (VC) associated oligoasthenospermia research[1][2][4]. |
| Name | [2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1λ6,2-benzothiazin-4-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Piroxicam cinnamate (Cinnoxicam) is a cyclooxygenase (COX) inhibitor, with anti-inflammatory activity. Piroxicam cinnamate is stable under gastric conditions, can be used for inflammatory-degenerative osteoarticular diseases, rheumatic disorders, and varicocele (VC) associated oligoasthenospermia research[1][2][4]. |
|---|---|
| Related Catalog | |
| In Vivo | Piroxicam cinnamate decreases plantar edema induced by egg's white in the rat's hind paw[3]. |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Melting Point | 261ºC |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.490 |
| Exact Mass | 461.104553 |
| PSA | 114.05000 |
| LogP | 3.96 |
| Index of Refraction | 1.697 |
| InChIKey | GPUVGQIASQNZET-CCEZHUSRSA-N |
| SMILES | CN1C(C(=O)Nc2ccccn2)=C(OC(=O)C=Cc2ccccc2)c2ccccc2S1(=O)=O |
| 3-Phenyl-2-propenoic Acid 2-Methyl-3-((2-pyridinylamino)carbonyl)-2H-1,2-benzothiazin-4-yl Ester S,S-Dioxide |
| 2-Methyl-1,1-dioxido-3-(2-pyridinylcarbamoyl)-2H-1,2-benzothiazin-4-yl (2E)-3-phenylacrylate |
| SPA-S-51O |
| SPA-S-510 |
| SPA-S 510 |
| 4-Hydroxy-2-methyl-N-2-pyridyl-2H-1,2-benzothiazine-3-carboxamide 1,1-Dioxide Cinnamate (Ester) |
| Cinnoxicam |
| Piroxicam cinnamate |
| Piroxicam cinnamic acid ester |
| 2-methyl-1,1-dioxido-3-(pyridin-2-ylcarbamoyl)-2H-1,2-benzothiazin-4-yl (2E)-3-phenylprop-2-enoate |
| 2-Propenoic acid, 3-phenyl-, 2-methyl-1,1-dioxido-3-[(2-pyridinylamino)carbonyl]-2H-1,2-benzothiazin-4-yl ester, (2E)- |
| Piroxicam cinnamate (USAN) |
| Sinartrol |