1-methyl-4-(2,4,6-trimethoxyphenyl)piperidine structure
|
Common Name | 1-methyl-4-(2,4,6-trimethoxyphenyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 872057-12-0 | Molecular Weight | 265.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-(2,4,6-trimethoxyphenyl)piperidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H23NO3 |
|---|---|
| Molecular Weight | 265.34800 |
| Exact Mass | 265.16800 |
| PSA | 30.93000 |
| LogP | 2.45950 |
| InChIKey | JAFMSXJVKKTNTD-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c(C2CCN(C)CC2)c(OC)c1 |
|
~96%
1-methyl-4-(2,4... CAS#:872057-12-0 |
| Literature: Liu, Xiaoling; Go, Mei-Lin Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 1 p. 153 - 163 |
|
~%
1-methyl-4-(2,4... CAS#:872057-12-0 |
| Literature: Liu, Xiaoling; Go, Mei-Lin Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 1 p. 153 - 163 |
|
~%
1-methyl-4-(2,4... CAS#:872057-12-0 |
| Literature: Liu, Xiaoling; Go, Mei-Lin Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 1 p. 153 - 163 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-methyl-4-(2,4,6-trimethoxyphenyl)piperidine |
| N-Methyl-4-(1-hydroxy-2-cyclopentenyl)-pyridinium-iodid |
| Pyridinium,4-(1-hydroxy-2-cyclopenten-1-yl)-1-methyl-,iodide |