4-(BOC-PIPERAZIN-1-YL)-3-NITROBENZOIC A&
Modify Date: 2025-08-25 10:02:04
4-(BOC-PIPERAZIN-1-YL)-3-NITROBENZOIC A& structure
|
Common Name | 4-(BOC-PIPERAZIN-1-YL)-3-NITROBENZOIC A& | ||
|---|---|---|---|---|
| CAS Number | 870703-72-3 | Molecular Weight | 351.35400 | |
| Density | 1.329g/cm3 | Boiling Point | 529.2ºC at 760 mmHg | |
| Molecular Formula | C16H21N3O6 | Melting Point | 199-203ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 273.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 529.2ºC at 760 mmHg |
| Melting Point | 199-203ºC (dec.)(lit.) |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.35400 |
| Flash Point | 273.8ºC |
| Exact Mass | 351.14300 |
| PSA | 115.90000 |
| LogP | 2.87620 |
| Index of Refraction | 1.582 |
| InChIKey | CYGRJUZYSXUAMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(=O)O)cc2[N+](=O)[O-])CC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[(tert-Butoxycarbonyl)-piperazin-1-yl]-3-nitrobenzoic acid |
| 1-Boc-4-(4-carboxy-2-nitrophenyl)piperazine |