(4,6-dimethoxy-1,3,5-triazin-2-yl)-trimethylazanium,chloride structure
|
Common Name | (4,6-dimethoxy-1,3,5-triazin-2-yl)-trimethylazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 87024-55-3 | Molecular Weight | 234.68300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4,6-dimethoxy-1,3,5-triazin-2-yl)-trimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H15ClN4O2 |
|---|---|
| Molecular Weight | 234.68300 |
| Exact Mass | 234.08800 |
| PSA | 57.13000 |
| InChIKey | JUZRGPJNDNWEKH-UHFFFAOYSA-M |
| SMILES | COc1nc(OC)nc([N+](C)(C)C)n1.[Cl-] |
|
~96%
(4,6-dimethoxy-... CAS#:87024-55-3 |
| Literature: Chesniuk; Mikhailichenko; Zavodnov; Zaplishny Chemistry of Heterocyclic Compounds, 2002 , vol. 38, # 2 p. 177 - 182 |
|
~%
(4,6-dimethoxy-... CAS#:87024-55-3 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4496392 A1, 1985 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-(4,6-dimethoxy-1,3,5-triazin-2-yl)-N,N,N-trimethylammonium chloride |
| trimethyl(4,6-dimethoxy-1,3,5-triazin-2-yl)ammonium chloride |
| 1,3,5-Triazin-2-aminium,4,6-dimethoxy-N,N,N-trimethyl-,chloride |
| 4,6-dimethoxy-[1,3,5]triazine-2-trimethyl-ammonium chloride |