Benzyl [(1S)-3-hydroxy-1-phenylpropyl]carbamate structure
|
Common Name | Benzyl [(1S)-3-hydroxy-1-phenylpropyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 869468-32-6 | Molecular Weight | 285.338 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 463.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.0±28.7 °C | |
| Name | Cbz-S-3-amino-3-phenylpropan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.4±45.0 °C at 760 mmHg |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.338 |
| Flash Point | 234.0±28.7 °C |
| Exact Mass | 285.136505 |
| PSA | 58.56000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | LHJCROXNTSGDSP-INIZCTEOSA-N |
| SMILES | O=C(NC(CCO)c1ccccc1)OCc1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzyl [(1S)-3-hydroxy-1-phenylpropyl]carbamate |
| N-[(1S)-3-Hydroxy-1-phenylpropyl]carbamic acid benzyl ester |
| (S)-3-(n-Cbz-amino)-3-phenylpropan-1-ol |
| Benzeneacetic acid, α-amino-α-(2-hydroxyethyl)-, phenylmethyl ester, (αS)- |
| Benzyl 2-phenyl-D-homoserinate |
| Carbamic acid, N-[(1S)-3-hydroxy-1-phenylpropyl]-, phenylmethyl ester |
| (S)-Cbz-3-Amino-3-phenylpropan-1-ol |