[(1S)-1-carbamoyl-2-(4-iodophenyl)ethyl]carbamic acid tert-butyl ester structure
|
Common Name | [(1S)-1-carbamoyl-2-(4-iodophenyl)ethyl]carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 868694-44-4 | Molecular Weight | 390.217 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 510.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H19IN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.7±30.1 °C | |
| Name | [(1S)-1-carbamoyl-2-(4-iodophenyl)ethyl]carbamic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 510.7±50.0 °C at 760 mmHg |
| Molecular Formula | C14H19IN2O3 |
| Molecular Weight | 390.217 |
| Flash Point | 262.7±30.1 °C |
| Exact Mass | 390.044037 |
| PSA | 81.42000 |
| LogP | 3.07 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | FGLIDWYLHHPLPF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(I)cc1)C(N)=O |
| HS Code | 2924299090 |
|---|
|
~10%
[(1S)-1-carbamo... CAS#:868694-44-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 48, # 21 p. 6544 - 6548 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-Butyl [(S)-1-amino-3-(4-iodophenyl)-1-oxopropan-2-yl]carbamate |
| 4-Iodo-Nα-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalaninamide |
| (S)-tert-butyl (1-amino-3-(4-iodophenyl)-1-oxopropan-2-yl)carbamate |
| Carbamic acid, N-[(1S)-2-amino-1-[(4-iodophenyl)methyl]-2-oxoethyl]-, 1,1-dimethylethyl ester |