5-Fluoro-1-triisopropylsilanyl-1H-pyrrolo[2,3-b]pyridine structure
|
Common Name | 5-Fluoro-1-triisopropylsilanyl-1H-pyrrolo[2,3-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 868387-37-5 | Molecular Weight | 292.46700 | |
| Density | 1.02g/cm3 | Boiling Point | 305.2ºC at 760 mmHg | |
| Molecular Formula | C16H25FN2Si | Melting Point | N/A | |
| MSDS | USA | Flash Point | 138.4ºC | |
| Name | (5-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 305.2ºC at 760 mmHg |
| Molecular Formula | C16H25FN2Si |
| Molecular Weight | 292.46700 |
| Flash Point | 138.4ºC |
| Exact Mass | 292.17700 |
| PSA | 17.82000 |
| LogP | 5.19900 |
| Index of Refraction | 1.514 |
| InChIKey | SLDZAKHBSRBYSM-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2cc(F)cnc21 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~49%
5-Fluoro-1-trii... CAS#:868387-37-5 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED Patent: WO2005/103050 A2, 2005 ; Location in patent: Page/Page column 180-189 ; WO 2005/103050 A2 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| A-6636 |
| 5-Fluoro-1-triisopropylsilanyl-1H-pyrrolo[2,3-b]pyridine |
| 5-fluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine |