1-(tert-butoxycarbonyl)azepane-4-carboxylic acid structure
|
Common Name | 1-(tert-butoxycarbonyl)azepane-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 868284-36-0 | Molecular Weight | 243.299 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 369.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.0±25.9 °C | |
| Name | 1-Boc-Azepane-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.0±35.0 °C at 760 mmHg |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.299 |
| Flash Point | 177.0±25.9 °C |
| Exact Mass | 243.147064 |
| PSA | 66.84000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | RZQHJTNUKFLYEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)O)CC1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
|
~%
1-(tert-butoxyc... CAS#:868284-36-0 |
| Literature: EP1736472 A1, ; Page/Page column 14-15 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-azepanecarboxylic acid |
| 1-(tert-butoxycarbonyl)azepane-4-carboxylic acid |
| 1H-Azepine-1,4-dicarboxylic acid, hexahydro-, 1-(1,1-dimethylethyl) ester |
| 1-[(2-methylpropan-2-yl)oxycarbonyl]azepane-4-carboxylic acid |
| 1-BOC-AZEPANE-4-CARBOXYLICACID |