(3S)-2',4',5'-trifluoro-3-hydroxybenzenebutanoic acid structure
|
Common Name | (3S)-2',4',5'-trifluoro-3-hydroxybenzenebutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 868071-17-4 | Molecular Weight | 234.17200 | |
| Density | 1.459 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9F3O3 | Melting Point | 87ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3S)-3-hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.459 g/cm3 |
|---|---|
| Melting Point | 87ºC |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17200 |
| Exact Mass | 234.05000 |
| PSA | 57.53000 |
| LogP | 1.48200 |
| InChIKey | WHFKHBXZZAXQOD-LURJTMIESA-N |
| SMILES | O=C(O)CC(O)Cc1cc(F)c(F)cc1F |
| HS Code | 2918199090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (S)-3-Hydroxy-4-(2,4,5-trifluorophenyl)butanoic acid |
| (S)-3-hydroxy-4-(2,4,5-trifluorophenyl)butyric acid |
| 4-(2,4,5-trifluorophenyl)-3(S)-hydroxybutanoic acid |
| (3S)-2',4',5'-Trifluoro-3-hydroxybenzenebutanoic acid |
| 3(S)-4-(2,4,5-trifluorophenyl)-3-hydroxybutanoic acid |
| (3S)-3-hydroxy-4-(2,4,5-trifluorophenyl)-butyric acid |
| 3(S)-4-(2,4,5-trifluorophenyl)-3-hydroxybenzenebutanoic acid |