(2R)-2-Amino-3-methyl-1,1-diphenyl-1-butanol structure
|
Common Name | (2R)-2-Amino-3-methyl-1,1-diphenyl-1-butanol | ||
|---|---|---|---|---|
| CAS Number | 86695-06-9 | Molecular Weight | 255.355 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 424.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H21NO | Melting Point | 95-99ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 210.6±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (R)-(+)-2-Amino-3-methyl-1,1-diphenyl-1-butanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.7±40.0 °C at 760 mmHg |
| Melting Point | 95-99ºC(lit.) |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.355 |
| Flash Point | 210.6±27.3 °C |
| Exact Mass | 255.162308 |
| PSA | 46.25000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | LNQVZZGGOZBOQS-MRXNPFEDSA-N |
| SMILES | CC(C)C(N)C(O)(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922199090 |
|
~%
(2R)-2-Amino-3-... CAS#:86695-06-9 |
| Literature: WO2010/148191 A2, ; Page/Page column 45-49; 64 ; |
|
~26%
(2R)-2-Amino-3-... CAS#:86695-06-9 |
| Literature: Vabeno, Jon; Brisander, Magnus; Lejon, Tore; Luthman, Kristina Journal of Organic Chemistry, 2002 , vol. 67, # 26 p. 9186 - 9191 |
|
~%
(2R)-2-Amino-3-... CAS#:86695-06-9 |
| Literature: Journal of Organic Chemistry, , vol. 67, # 26 p. 9186 - 9191 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenemethanol, α-[(1R)-1-amino-2-methylpropyl]-α-phenyl- |
| (2R)-2-Amino-3-methyl-1,1-diphenyl-1-butanol |
| (r)-(+)-2-amino-3-methyl-1,1-diphenyl-1-butanol |
| MFCD01318247 |
| (2R)-2-Amino-3-methyl-1,1-diphenylbutan-1-ol |