URB754 structure
|
Common Name | URB754 | ||
|---|---|---|---|---|
| CAS Number | 86672-58-4 | Molecular Weight | 266.295 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 434.0±48.0 °C at 760 mmHg | |
| Molecular Formula | C16H14N2O2 | Melting Point | 238-240ºC | |
| MSDS | N/A | Flash Point | 216.3±29.6 °C | |
Use of URB754URB754 is a potent inhibitor of the endocannabinoid-deactivating enzyme monoacylglycerol lipase (MGL) with an IC50 of 200 nM[1]. |
| Name | 6-Methyl-2-(p-tolylamino)-4H-benzo[d][1,3]oxazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | URB754 is a potent inhibitor of the endocannabinoid-deactivating enzyme monoacylglycerol lipase (MGL) with an IC50 of 200 nM[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.0±48.0 °C at 760 mmHg |
| Melting Point | 238-240ºC |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.295 |
| Flash Point | 216.3±29.6 °C |
| Exact Mass | 266.105530 |
| PSA | 55.13000 |
| LogP | 3.54 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | GFWNGVKCDGYFKG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2nc3ccc(C)cc3c(=O)o2)cc1 |
| HS Code | 2934999090 |
|---|
|
~%
URB754 CAS#:86672-58-4 |
| Literature: Synthesis, , # 5 p. 406 - 408 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methyl-2-(4-toluidino)-4H-3,1-benzoxazin-4-one |
| 6-methyl-2-(4-methylanilino)-3,1-benzoxazin-4-one |
| 6-Methyl-2-[(4-methylphenyl)amino]-4H-3,1-benzoxazin-4-one |
| 4H-3,1-Benzoxazin-4-one, 6-methyl-2-[(4-methylphenyl)amino]- |
| URB754 |