4-oxo-4-HPR
Modify Date: 2025-09-06 09:14:32
4-oxo-4-HPR structure
|
Common Name | 4-oxo-4-HPR | ||
|---|---|---|---|---|
| CAS Number | 865536-65-8 | Molecular Weight | 405.53 | |
| Density | 1.131g/cm3 | Boiling Point | 641.8ºC at 760 mmHg | |
| Molecular Formula | C26H31NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.9ºC | |
Use of 4-oxo-4-HPR4-Oxofenretinide (4-Oxo-4-HPR) is a metabolite of Fenretinide (HY-15373). 4-Oxofenretinide induces cell growth inhibition in ovarian, breast, and neuroblastoma tumor cell lines. 4-Oxofenretinide causes a marked accumulation of cells in G2-M. 4-Oxofenretinide induces cancer cell apoptosis through caspase-9[1]. |
| Name | (2E,4E,6E,8E)-N-(4-hydroxyphenyl)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Oxofenretinide (4-Oxo-4-HPR) is a metabolite of Fenretinide (HY-15373). 4-Oxofenretinide induces cell growth inhibition in ovarian, breast, and neuroblastoma tumor cell lines. 4-Oxofenretinide causes a marked accumulation of cells in G2-M. 4-Oxofenretinide induces cancer cell apoptosis through caspase-9[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 641.8ºC at 760 mmHg |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.53 |
| Flash Point | 341.9ºC |
| Exact Mass | 405.23000 |
| PSA | 66.40000 |
| LogP | 6.11430 |
| Index of Refraction | 1.615 |
| InChIKey | NZVOGZATHCUFRC-KFJFTADJSA-N |
| SMILES | CC(C=CC1=C(C)C(=O)CCC1(C)C)=CC=CC(C)=CC(=O)Nc1ccc(O)cc1 |
| Storage condition | -20℃ |
| 4-oxo-4-HPR |
| N-(4-Hydroxyphenyl)-4-oxoretinamide |
| 4-oxo-N-(4-hydroxyphenyl)retinamide |
| 3-Keto fenretinide |
| 4-Oxo Fenretinide |
| 4-Keto-4-HPR |