Aristolindiquinone
Modify Date: 2025-08-25 12:50:57
Aristolindiquinone structure
|
Common Name | Aristolindiquinone | ||
|---|---|---|---|---|
| CAS Number | 86533-36-0 | Molecular Weight | 218.20500 | |
| Density | 1.452g/cm3 | Boiling Point | 400.9ºC at 760 mmHg | |
| Molecular Formula | C12H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4ºC | |
Use of AristolindiquinoneAristolindiquinone can be isolated from Aristolwhia indica[1]. |
| Name | 4,5-dihydroxy-3,8-dimethylnaphthalene-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Aristolindiquinone can be isolated from Aristolwhia indica[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 400.9ºC at 760 mmHg |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.20500 |
| Flash Point | 210.4ºC |
| Exact Mass | 218.05800 |
| PSA | 74.60000 |
| LogP | 1.75500 |
| Index of Refraction | 1.666 |
| InChIKey | SJBCQYINLQWMKL-UHFFFAOYSA-N |
| SMILES | CC1=C(O)c2c(O)ccc(C)c2C(=O)C1=O |
| HS Code | 2914690090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:20515-19-9![2-METHOXY-3-METHYL-[1,4]BENZOQUINONE Structure](https://image.chemsrc.com/caspic/299/2207-57-0.png)
CAS#:2207-57-0| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,5-dihydroxy-3,8-dimethyl-1,4-naphthoquinone |
| aristolindiquinone |