Stachyanthuside A structure
|
Common Name | Stachyanthuside A | ||
|---|---|---|---|---|
| CAS Number | 864779-30-6 | Molecular Weight | 478.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H18O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Stachyanthuside AStachyanthuside A is an ellagic acid glycoside isolated from the leaves of Diplopanax stachyanthus[1]. |
| Name | Stachyanthuside A |
|---|
| Description | Stachyanthuside A is an ellagic acid glycoside isolated from the leaves of Diplopanax stachyanthus[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H18O13 |
|---|---|
| Molecular Weight | 478.36 |
| InChIKey | BBCVPHJIWIMGCN-OZJCBLQYSA-N |
| SMILES | COc1c(O)cc2c(=O)oc3c(O)c(OC4OC(CO)C(O)C(O)C4O)cc4c(=O)oc1c2c34 |
| Hazard Codes | Xi |
|---|