6-(2-(2,6,6-trimethyl-1-cyclohexen-1-yl)ethen-1-yl)-2-naphthalenecarboxylic acid
6-(2-(2,6,6-trimethyl-1-cyclohexen-1-yl)ethen-1-yl)-2-naphthalenecarboxylic acid structure
|
Common Name | 6-(2-(2,6,6-trimethyl-1-cyclohexen-1-yl)ethen-1-yl)-2-naphthalenecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 86471-13-8 | Molecular Weight | 320.42500 | |
| Density | 1.148g/cm3 | Boiling Point | 488.1ºC at 760 mmHg | |
| Molecular Formula | C22H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 488.1ºC at 760 mmHg |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.42500 |
| Flash Point | 225.8ºC |
| Exact Mass | 320.17800 |
| PSA | 37.30000 |
| LogP | 6.07780 |
| Index of Refraction | 1.662 |
| InChIKey | RCHMLZNVEBARAC-YRNVUSSQSA-N |
| SMILES | CC1=C(C=Cc2ccc3cc(C(=O)O)ccc3c2)C(C)(C)CCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~76%
6-(2-(2,6,6-tri... CAS#:86471-13-8 |
| Literature: SRI International Patent: US4456618 A1, 1984 ; |
|
~%
6-(2-(2,6,6-tri... CAS#:86471-13-8 |
| Literature: Dawson, Marcia I.; Chan, Rebecca L.-S.; Derdzinski, Krzysztof; Hobbs, Peter D.; Chao, Wan-Ru; Schiff, Leonard J. Journal of Medicinal Chemistry, 1983 , vol. 26, # 11 p. 1653 - 1656 |
|
~%
6-(2-(2,6,6-tri... CAS#:86471-13-8 |
| Literature: Dawson, Marcia I.; Chan, Rebecca L.-S.; Derdzinski, Krzysztof; Hobbs, Peter D.; Chao, Wan-Ru; Schiff, Leonard J. Journal of Medicinal Chemistry, 1983 , vol. 26, # 11 p. 1653 - 1656 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (E)-6-[2-(2,6,6-trimethyl-1-cyclohexen-1-yl)-ethenyl]-2-naphthalene carboxylic acid |
| 6-(2-(2,6,6-Trimethyl-1-cyclohexen-1-yl)ethen-1-yl)-2-naphthalenecarboxylic acid |
| 6-[(E)-2-(2,6,6-trimethyl-1-cyclohexen-1-yl)ethen-1-yl]-2-naphthalenecarboxylic acid |
| 6-[2-(2,6,6-trimethyl-1-cyclohexen-1-yl)ethenyl]-2-naphthoic acid |
| (E)-6-[2-(2,6,6-trimethyl-1-cyclohexen-1-yl)ethen-1-yl]-2-naphthalene carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid? |
| A: The English name of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid is 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid. |
| Q: What is the CAS number of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid? |
| A: CAS number of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid is 86471-13-8. |
| Q: What is the molecular formula of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid? |
| A: Molecular formula of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid is C22H24O2. |
| Q: What is the InChIKey of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid? |
| A: InChIKey of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid is RCHMLZNVEBARAC-YRNVUSSQSA-N. |
| Q: What is the SMILES notation of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid? |
| A: SMILES notation of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid is CC1=C(C=Cc2ccc3cc(C(=O)O)ccc3c2)C(C)(C)CCC1. |
| Q: What is the LogP of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid? |
| A: LogP of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid is 6.07780. |
| Q: What is the boiling point of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid? |
| A: Boiling point of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid is 488.1ºC at 760 mmHg. |
| Q: What is the Chinese name of 86471-13-8? |
| A: Chinese name of 86471-13-8 is 86471-13-8. |
| Q: What is the polar surface area (PSA) of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid? |
| A: Polar surface area (PSA) of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid is 37.30000. |
| Q: What is the molecular weight of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid? |
| A: Molecular weight of 6-[2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]naphthalene-2-carboxylic acid is 320.42500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |