tert-Butyl 5-cyano-3-iodo-1H-indole-1-carboxylate structure
|
Common Name | tert-Butyl 5-cyano-3-iodo-1H-indole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 864685-26-7 | Molecular Weight | 368.170 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 452.3±48.0 °C at 760 mmHg | |
| Molecular Formula | C14H13IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.4±29.6 °C | |
| Name | tert-butyl 5-cyano-3-iodoindole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.3±48.0 °C at 760 mmHg |
| Molecular Formula | C14H13IN2O2 |
| Molecular Weight | 368.170 |
| Flash Point | 227.4±29.6 °C |
| Exact Mass | 368.002167 |
| PSA | 55.02000 |
| LogP | 4.33 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | GADLXNFRAAUWAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1cc(I)c2cc(C#N)ccc21 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~99%
tert-Butyl 5-cy... CAS#:864685-26-7 |
| Literature: Kyowa Hakko Kirin Co., Ltd. Patent: EP2163554 A1, 2010 ; Location in patent: Page/Page column 107 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 5-cyano-3-iodo-1H-indole-1-carboxylate |
| 1H-Indole-1-carboxylic acid, 5-cyano-3-iodo-, 1,1-dimethylethyl ester |
| tert-butyl 5-cyano-3-iodo-1H-indole-1-carboxylate |
| 1-Boc-5-cyano-3-iodoindole |
| 1-tert-butoxycarbonyl-5-cyano-3-iodoindole |