Sanggenone H
Modify Date: 2025-08-23 15:29:22
Sanggenone H structure
|
Common Name | Sanggenone H | ||
|---|---|---|---|---|
| CAS Number | 86450-80-8 | Molecular Weight | 354.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sanggenone HSanggenone H is found in Morus alba L[1]. |
| Name | Sanggenone H |
|---|---|
| Synonym | More Synonyms |
| Description | Sanggenone H is found in Morus alba L[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Tang W., Eisenbrand G. Morus alba L. Chinese Drugs of Plant Origin, 1992. |
| Molecular Formula | C20H18O6 |
|---|---|
| Molecular Weight | 354.35 |
| Exact Mass | 354.11000 |
| PSA | 96.22000 |
| LogP | 3.69410 |
| InChIKey | QPAKXSCQEJXHSW-INIZCTEOSA-N |
| SMILES | CC1(C)C=Cc2c(O)ccc(C3CC(=O)c4c(O)cc(O)cc4O3)c2O1 |
| (S)-5,7,5'-Trihydroxy-2',2'-dimethyl-2,3-dihydro-2'H-[2,8']bichromenyl-4-one |