methyl 2-tert-butyl-3-hydroxy-3-methylbutanoate structure
|
Common Name | methyl 2-tert-butyl-3-hydroxy-3-methylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 86426-15-5 | Molecular Weight | 188.26400 | |
| Density | 0.965g/cm3 | Boiling Point | 254.1ºC at 760 mmHg | |
| Molecular Formula | C10H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.1ºC | |
| Name | methyl 2-tert-butyl-3-hydroxy-3-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 254.1ºC at 760 mmHg |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.26400 |
| Flash Point | 95.1ºC |
| Exact Mass | 188.14100 |
| PSA | 46.53000 |
| LogP | 1.59260 |
| Index of Refraction | 1.441 |
| InChIKey | YTXMWYDKVFFAMI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C)(C)C)C(C)(C)O |
|
~74%
methyl 2-tert-b... CAS#:86426-15-5 |
| Literature: Wenke, G.; Jacobsen, E. N.; Totten, G. E.; Karydas, A. C.; Rhodes, Y. E. Synthetic Communications, 1983 , vol. 13, # 6 p. 449 - 458 |
|
~%
methyl 2-tert-b... CAS#:86426-15-5 |
| Literature: Furuhata, Akimichi; Hirano, Masachika; Fujimoto, Izumi; Matsui, Masano Agricultural and Biological Chemistry, 1987 , vol. 51, # 6 p. 1633 - 1640 |
| methyl 2-t-butyl-3-hydroxy-3-methylbutanoate |
| methyl 2-(2-hydroxypropan-2-yl)-3,3-dimethyl-butanoate |
| Butanoic acid,2-(1,1-dimethylethyl)-3-hydroxy-3-methyl-,methyl ester |