RAFT polymerization agent structure
|
Common Name | RAFT polymerization agent | ||
|---|---|---|---|---|
| CAS Number | 864066-74-0 | Molecular Weight | 376.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O4S2 | Melting Point | 166 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | scpdb |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 166 °C |
|---|---|
| Molecular Formula | C17H16N2O4S2 |
| Molecular Weight | 376.45000 |
| Exact Mass | 376.05500 |
| PSA | 144.86000 |
| LogP | 2.70288 |
| InChIKey | XQQHRPPQBDALBV-UHFFFAOYSA-N |
| SMILES | CC(C#N)(CCC(=O)ON1C(=O)CCC1=O)SC(=S)c1ccccc1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| Hazard Codes | T+ |
| RIDADR | UN 2811 6.1 / PGIII |
|
Universal (switchable) RAFT agents.
Material Matters 5 , 2, (2010) The polymerization of most monomers that are polymerizable by radical polymerization can be controlled by the reversible addition-fragmentation chain transfer (RAFT) process. However, it is usually re... |
| 4-cyano-4-((thiobenzoyl)sulfanyl)pentanoic succinimide ester |
| succinimido-2-[[2-phenyl-1-thioxo]thio]-4-cyanopentanoate |
| 4-cyano-4-((thiobenzoyl)sulfanyl) pentanoicsuccinimide ester |
| 4-Cyano-4-methyl-4-thiobenzoylsulfanyl-butyric acid 2,5-dioxo-pyrrolidin-1-yl ester |
| 4-cyano-4′-{(2-phenyl-1-thioxo)thio}pentanoic succinimide |