3H-1,2,4-Triazol-3-one,4-(4-fluorophenyl)-2,4 structure
|
Common Name | 3H-1,2,4-Triazol-3-one,4-(4-fluorophenyl)-2,4 | ||
|---|---|---|---|---|
| CAS Number | 860650-96-0 | Molecular Weight | 193.178 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H8FN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-fluorophenyl)-3-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.178 |
| Exact Mass | 193.065140 |
| PSA | 50.94000 |
| LogP | 0.02 |
| Index of Refraction | 1.626 |
| InChIKey | BATKZKFLRJTOLB-UHFFFAOYSA-N |
| SMILES | Cc1n[nH]c(=O)n1-c1ccc(F)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-Fluorophenyl)-5-methyl-2,4-dihydro-3H-1,2,4-triazol-3-one |
| 3H-1,2,4-Triazol-3-one, 4-(4-fluorophenyl)-2,4-dihydro-5-methyl- |
| 3H-1,2,4-Triazol-3-one,4-(4-fluorophenyl)-2,4 |