3H-1,2,4-Triazol-3-one,4-(4-chlorophenyl)-2,4-dihydro-2,5-dimethyl-
Modify Date: 2025-09-11 14:12:29
3H-1,2,4-Triazol-3-one,4-(4-chlorophenyl)-2,4-dihydro-2,5-dimethyl- structure
|
Common Name | 3H-1,2,4-Triazol-3-one,4-(4-chlorophenyl)-2,4-dihydro-2,5-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 494785-65-8 | Molecular Weight | 223.659 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 311.0±44.0 °C at 760 mmHg | |
| Molecular Formula | C10H10ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.9±28.4 °C | |
| Name | 4-(4-chlorophenyl)-2,5-dimethyl-1,2,4-triazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 311.0±44.0 °C at 760 mmHg |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.659 |
| Flash Point | 141.9±28.4 °C |
| Exact Mass | 223.051239 |
| PSA | 39.82000 |
| LogP | 0.33 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | YNQQKMBICQHZMJ-UHFFFAOYSA-N |
| SMILES | Cc1nn(C)c(=O)n1-c1ccc(Cl)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-Chlorophenyl)-2,5-dimethyl-2,4-dihydro-3H-1,2,4-triazol-3-one |
| 3H-1,2,4-Triazol-3-one, 4-(4-chlorophenyl)-2,4-dihydro-2,5-dimethyl- |
| 3H-1,2,4-Triazol-3-one,4-(4-chlorophenyl)-2,4-dihydro-2,5-dimethyl- |