4-(2,5-Diethoxy-4-nitrophenyl)morpholine
Modify Date: 2024-01-06 19:25:14
4-(2,5-Diethoxy-4-nitrophenyl)morpholine structure
|
Common Name | 4-(2,5-Diethoxy-4-nitrophenyl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 86-16-8 | Molecular Weight | 296.31900 | |
| Density | 1.206g/cm3 | Boiling Point | 475.6ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O5 | Melting Point | 137-141 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 241.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(2,5-Diethoxy-4-nitrophenyl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 475.6ºC at 760 mmHg |
| Melting Point | 137-141 °C(lit.) |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.31900 |
| Flash Point | 241.4ºC |
| Exact Mass | 296.13700 |
| PSA | 76.75000 |
| LogP | 2.81700 |
| Index of Refraction | 1.541 |
| InChIKey | KNHGNICBXADRMC-UHFFFAOYSA-N |
| SMILES | CCOc1cc([N+](=O)[O-])c(OCC)cc1N1CCOCC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Morpholine,4-(2,5-diethoxy-4-nitrophenyl) |
| EINECS 201-653-6 |
| 2,5-diethoxy-4-morpholin-4-yl-1-nitrobenzene |
| MFCD00023311 |