4,4'-bis-(2,3-Epoxypropoxy)-3,3',5,5'-tetramethylbiphenyl structure
|
Common Name | 4,4'-bis-(2,3-Epoxypropoxy)-3,3',5,5'-tetramethylbiphenyl | ||
|---|---|---|---|---|
| CAS Number | 85954-11-6 | Molecular Weight | 354.439 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 473.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H26O4 | Melting Point | 105ºC | |
| MSDS | N/A | Flash Point | 131.8±35.6 °C | |
| Name | 4,4'-Bis(2,3-epoxypropoxy)-3,3',5,5'-tetramethylbiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 473.5±45.0 °C at 760 mmHg |
| Melting Point | 105ºC |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.439 |
| Flash Point | 131.8±35.6 °C |
| Exact Mass | 354.183105 |
| PSA | 43.52000 |
| LogP | 4.66 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | HRSLYNJTMYIRHM-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2cc(C)c(OCC3CO3)c(C)c2)cc(C)c1OCC1CO1 |
|
~15%
4,4'-bis-(2,3-E... CAS#:85954-11-6 |
| Literature: US2012/29217 A1, ; Page/Page column 6-7 ; |
|
~%
4,4'-bis-(2,3-E... CAS#:85954-11-6 |
| Literature: Xenobiotica, , vol. 30, # 5 p. 469 - 483 |
|
~%
4,4'-bis-(2,3-E... CAS#:85954-11-6 |
| Literature: Van Elburg; Ormskerk; De Kloe; Boogaard Journal of Labelled Compounds and Radiopharmaceuticals, 2000 , vol. 43, # 2 p. 147 - 167 |
|
~%
4,4'-bis-(2,3-E... CAS#:85954-11-6 |
| Literature: Journal of Labelled Compounds and Radiopharmaceuticals, , vol. 43, # 2 p. 147 - 167 |
| 2,2'-[(3,3',5,5'-Tetramethyl-4,4'-biphenyldiyl)bis(oxymethylene)]dioxirane |
| 2-[[4-[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]-2,6-dimethylphenoxy]methyl]oxirane |
| Oxirane, 2,2'-[(3,3',5,5'-tetramethyl[1,1'-biphenyl]-4,4'-diyl)bis(oxymethylene)]bis- |
| 2,2'-[(3,3',5,5'-Tetramethylbiphenyl-4,4'-diyl)bis(oxymethylene)]dioxirane |
| 2,2'-[(3,3',5,5'-Tetramethylbiphenyl-4,4'-diyl)bis(oxymethylene)]bisoxirane |
| EINECS 413-900-7 |
| 2,2'-[(3,3',5,5'-Tetramethyl[1,1'-biphenyl]-4,4'-diyl)bis(oxymethylene)]bis(oxirane) |