(Z)-11-HEXADECEN-1-YLACETATE structure
|
Common Name | (Z)-11-HEXADECEN-1-YLACETATE | ||
|---|---|---|---|---|
| CAS Number | 85907-66-0 | Molecular Weight | 209.67200 | |
| Density | 1.143g/cm3 | Boiling Point | 425.4ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO | Melting Point | 123-125ºC | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | 2-(4-chlorophenyl)-3-(dimethylamino)prop-2-enal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 425.4ºC at 760 mmHg |
| Melting Point | 123-125ºC |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.67200 |
| Flash Point | 211.1ºC |
| Exact Mass | 209.06100 |
| PSA | 20.31000 |
| LogP | 2.44140 |
| Index of Refraction | 1.555 |
| InChIKey | WYRALGSIFBXIIV-JXMROGBWSA-N |
| SMILES | CN(C)C=C(C=O)c1ccc(Cl)cc1 |
| HS Code | 2922399090 |
|---|
|
~%
(Z)-11-HEXADECE... CAS#:85907-66-0 |
| Literature: US4282242 A1, ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-(p-Chlor-phenyl)-3-dimethylamino-acrolein |
| 2-(4-chlorophenyl)-3-(dimethylamino)acrolein |
| 2-(4-chlorophenyl)-3-dimethylaminoacrylaldehyde |
| 2-(p-chlorophenyl)-3-dimethylaminoprop-2-enal |
| 2-(4-chlorophenyl)-3-dimethylaminopropenal |
| (Z)-2-(4-chlorophenyl)-3-(dimethylamino)-2-propenal |
| Benzeneacetaldehyde,4-chloro-a-[(dimethylamino)methylene]-,(aZ) |
| 2-(4-Chlorophenyl)-3-(dimethylamino)-2-propenal |
| Benzeneacetaldehyde,4-chloro-a-[(dimethylamino)methylene]-,(Z)-(9CI) |