2-hydroxynaphthalene-1,4-disulphonic acid structure
|
Common Name | 2-hydroxynaphthalene-1,4-disulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 85895-99-4 | Molecular Weight | 304.29600 | |
| Density | 1.816g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H8O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxynaphthalene-1,4-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.816g/cm3 |
|---|---|
| Molecular Formula | C10H8O7S2 |
| Molecular Weight | 304.29600 |
| Exact Mass | 303.97100 |
| PSA | 145.73000 |
| LogP | 3.20040 |
| Index of Refraction | 1.725 |
| InChIKey | BCIGEHNLIIQCBS-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(O)c(S(=O)(=O)O)c2ccccc12 |
| HS Code | 2908999090 |
|---|
|
~%
2-hydroxynaphth... CAS#:85895-99-4 |
| Literature: Bogdanov, S. V. Zhurnal Obshchei Khimii, 1939 , vol. 9, p. 1145 - 1147 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Naphthol-(2)-disulfonsaeure-(1.4) |
| 2-Hydroxynaphthalene-1,4-disulphonic acid |
| 2-hydroxy-naphthalene-1,4-disulfonic acid |
| EINECS 288-775-3 |
| 2-Hydroxy-naphthalin-1,4-disulfonsaeure |
| 2-naphthol-1,4-disulfonic acid |