HC ORANGE NO. 2 structure
|
Common Name | HC ORANGE NO. 2 | ||
|---|---|---|---|---|
| CAS Number | 85765-48-6 | Molecular Weight | 241.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(2-aminoethylamino)-3-nitrophenoxy]ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15N3O4 |
|---|---|
| Molecular Weight | 241.24400 |
| Exact Mass | 241.10600 |
| PSA | 113.33000 |
| LogP | 1.63300 |
| InChIKey | WXGKXLXGYOYZMX-UHFFFAOYSA-N |
| SMILES | NCCNc1ccc(OCCO)cc1[N+](=O)[O-] |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethanol,2-(4-((2-aminoethyl)amino)-3-nitrophenoxy) |
| HC Orange 2 |
| HC Orange no. 2 |
| Imexine FAB |