2,2'-[4-(2-Hydroxyethylamino)-3-nitrophenylimino]diethanol structure
|
Common Name | 2,2'-[4-(2-Hydroxyethylamino)-3-nitrophenylimino]diethanol | ||
|---|---|---|---|---|
| CAS Number | 33229-34-4 | Molecular Weight | 285.29600 | |
| Density | 1.421 g/cm3 | Boiling Point | 582.7ºC at 760 mmHg | |
| Molecular Formula | C12H19N3O5 | Melting Point | 108-111 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[4-[bis(2-hydroxyethyl)amino]-2-nitroanilino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421 g/cm3 |
|---|---|
| Boiling Point | 582.7ºC at 760 mmHg |
| Melting Point | 108-111 °C(lit.) |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.29600 |
| Exact Mass | 285.13200 |
| PSA | 121.78000 |
| LogP | 0.38620 |
| Index of Refraction | 1.672 |
| InChIKey | MIWUTEVJIISHCP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(N(CCO)CCO)ccc1NCCO |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | KL2880000 |
| HS Code | 2922199090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Self-Healing Supramolecular Polymers In Action. van Gemert GML, et al.
Macromol. Chem. Phys. 213(2) , 234-42, (2012)
|
|
|
NTP Toxicology and Carcinogenesis Studies of HC Blue No. 2 [2,2'-((4-((2-Hydroxyethyl)amino)-3-nitrophenyl)imino)bis(ethanol)] (CAS No. 33229-34-4) in F344/N Rats and B6C3F 1 Mice (Feed Studies).
Natl. Toxicol. Program Tech. Rep. Ser. 293 , 1-192, (1985) Toxicology and carcinogenesis studies of HC Blue No. 2 (approximately 98% pure), a semipermanent hair dye, were conducted by administering the test chemical in feed for 103 weeks to groups of 50 F344/... |
|
|
HC Blue No. 2.
IARC Monogr. Eval. Carcinog. Risks Hum. 57 , 143-51, (1993)
|
| 2,2'-(4-(2-hydroxyethylamino)-3-nitro-phenylimino |
| EINECS 251-410-3 |
| N1,N4,N4-Tris(2-hydroxyethyl)-2-nitro-1,4-phenylenediamine |
| HC Blue no. 2 |
| 2,2′-[4-(2-Hydroxyethylamino)-3-nitrophenylimino]diethanol |
| MFCD00071762 |
| 2,2'-[4-(2-HydroxyethylaMino)-3-nitrophenyliMino]diethanol |
| HC BLUE #2 |