Urea,1-acetyl-3-pivalyl- (4CI)
Modify Date: 2025-09-19 19:12:21
Urea,1-acetyl-3-pivalyl- (4CI) structure
|
Common Name | Urea,1-acetyl-3-pivalyl- (4CI) | ||
|---|---|---|---|---|
| CAS Number | 854643-13-3 | Molecular Weight | 186.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(acetylcarbamoyl)-2,2-dimethylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H14N2O3 |
|---|---|
| Molecular Weight | 186.20800 |
| Exact Mass | 186.10000 |
| PSA | 82.25000 |
| LogP | 2.08540 |
| InChIKey | SFRLJQAAZYYBTE-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(=O)NC(=O)C(C)(C)C |
|
~%
Urea,1-acetyl-3... CAS#:854643-13-3 |
| Literature: Stoughton; Dickison; Fitzhugh Journal of the American Chemical Society, 1939 , vol. 61, p. 409 |
|
~%
Urea,1-acetyl-3... CAS#:854643-13-3 |
| Literature: Stoughton; Dickison; Fitzhugh Journal of the American Chemical Society, 1939 , vol. 61, p. 409 |
| N-Acetyl-N'-trimethylacetyl-harnstoff |
| N-acetyl-N'-pivaloyl-urea |
| N-Acetyl-N'-pivaloyl-harnstoff |