(3-Bromo-4-(trifluoromethoxy)phenyl)methanol structure
|
Common Name | (3-Bromo-4-(trifluoromethoxy)phenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 85366-65-0 | Molecular Weight | 271.03100 | |
| Density | 1.695g/cm3 | Boiling Point | 262.5ºC at 760 mmHg | |
| Molecular Formula | C8H6BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.6ºC | |
| Name | [3-bromo-4-(trifluoromethoxy)phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.695g/cm3 |
|---|---|
| Boiling Point | 262.5ºC at 760 mmHg |
| Molecular Formula | C8H6BrF3O2 |
| Molecular Weight | 271.03100 |
| Flash Point | 112.6ºC |
| Exact Mass | 269.95000 |
| PSA | 29.46000 |
| LogP | 2.84000 |
| Index of Refraction | 1.506 |
| InChIKey | YAUHBCKVTDXCDQ-UHFFFAOYSA-N |
| SMILES | OCc1ccc(OC(F)(F)F)c(Br)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2909499000 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3-bromo-4-(trifluoromethoxy)benzyl alcohol |
| PC2473 |
| (3-bromo-4-(trifluoromethoxy)phenyl)methanol |