4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl azide
Modify Date: 2025-08-27 12:08:54
4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl azide structure
|
Common Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl azide | ||
|---|---|---|---|---|
| CAS Number | 852527-60-7 | Molecular Weight | 403.14300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6F13N3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 9-Azido-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorononane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H6F13N3 |
|---|---|
| Molecular Weight | 403.14300 |
| Exact Mass | 403.03500 |
| PSA | 49.75000 |
| LogP | 5.26846 |
| Index of Refraction | n20/D1.342 |
| InChIKey | DQEDVGBNEFVPEU-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2929909090 |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-(Perfluorohexyl)propyl azide |
| 1H,1H,2H,2H,3H,3H-Perfluorononyl azide |
| 4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl azide |