Z-Hyp(tBu)-OH structure
|
Common Name | Z-Hyp(tBu)-OH | ||
|---|---|---|---|---|
| CAS Number | 85201-91-8 | Molecular Weight | 321.36800 | |
| Density | 1.21 | Boiling Point | 470.2°C at 760 mmHg | |
| Molecular Formula | C17H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S,4R)-4-[(2-methylpropan-2-yl)oxy]-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21 |
|---|---|
| Boiling Point | 470.2°C at 760 mmHg |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.36800 |
| Exact Mass | 321.15800 |
| PSA | 76.07000 |
| LogP | 2.60370 |
| Appearance of Characters | Solid |
| InChIKey | YCTNIMOEFJORHQ-KGLIPLIRSA-N |
| SMILES | CC(C)(C)OC1CC(C(=O)O)N(C(=O)OCc2ccccc2)C1 |
| Storage condition | Store at RT. |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~86%
Z-Hyp(tBu)-OH CAS#:85201-91-8 |
| Literature: Galpin; Mohammed; Patel Tetrahedron, 1988 , vol. 44, # 6 p. 1773 - 1782 |
|
~%
Z-Hyp(tBu)-OH CAS#:85201-91-8 |
| Literature: Galpin; Mohammed; Patel Tetrahedron, 1988 , vol. 44, # 6 p. 1773 - 1782 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2S,4R)-1-(benzyloxycarbonyl)-4-tert-butoxypyrrolidine-2-carboxylic acid |
| Z-Hyp(t-Bu)-OH |
| (2S,4R)-4-tert-butoxy-pyrrolidine-1,2-dicarboxylic acid 1-benzyl ester |
| Z-O-tert-butyl-L-4-hydroxyproline |
| (4R)-(tert-Butoxy)-1-(phenylmethoxycarbonyl)-L-proline |
| Z-Hyp(tBu)-OH |