1,6-Dibromo-2,3,5-trichlorononafluorohexane
Modify Date: 2025-11-26 15:36:56
1,6-Dibromo-2,3,5-trichlorononafluorohexane structure
|
Common Name | 1,6-Dibromo-2,3,5-trichlorononafluorohexane | ||
|---|---|---|---|---|
| CAS Number | 85131-86-8 | Molecular Weight | 509.21700 | |
| Density | 2.144g/cm3 | Boiling Point | 249.5ºC at 760 mmHg | |
| Molecular Formula | C6Br2Cl3F9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.7ºC | |
| Name | 1,6-dibromo-2,3,5-trichloro-1,1,2,3,4,4,5,6,6-nonafluorohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.144g/cm3 |
|---|---|
| Boiling Point | 249.5ºC at 760 mmHg |
| Molecular Formula | C6Br2Cl3F9 |
| Molecular Weight | 509.21700 |
| Flash Point | 104.7ºC |
| Exact Mass | 505.72900 |
| LogP | 6.31090 |
| Index of Refraction | 1.428 |
| InChIKey | RKKGNUHLABLELO-UHFFFAOYSA-N |
| SMILES | FC(F)(Br)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(Cl)C(F)(F)Br |
| HS Code | 2903799090 |
|---|
|
~%
1,6-Dibromo-2,3... CAS#:85131-86-8 |
| Literature: Dedek, V.; Chvatal, Z. Journal of Fluorine Chemistry, 1986 , vol. 31, p. 363 - 380 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,6-Dibromo-2,3,5-trichlorononafluorohexane |