1,4-Dibromo-2,3-dichlorohexafluorobutane
Modify Date: 2025-10-31 15:21:15
1,4-Dibromo-2,3-dichlorohexafluorobutane structure
|
Common Name | 1,4-Dibromo-2,3-dichlorohexafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 375-42-8 | Molecular Weight | 392.74700 | |
| Density | 2.224g/cm3 | Boiling Point | 135.5ºC at 760mmHg | |
| Molecular Formula | C4Br2Cl2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 35.7ºC | |
| Name | 1,4-Dibromo-2,3-dichloro-1,1,2,3,4,4-hexafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 2.224g/cm3 |
|---|---|
| Boiling Point | 135.5ºC at 760mmHg |
| Molecular Formula | C4Br2Cl2F6 |
| Molecular Weight | 392.74700 |
| Flash Point | 35.7ºC |
| Exact Mass | 389.76500 |
| LogP | 4.77100 |
| Index of Refraction | 1.44 |
| InChIKey | PFSLUJSDDNGKIZ-UHFFFAOYSA-N |
| SMILES | FC(F)(Br)C(F)(Cl)C(F)(Cl)C(F)(F)Br |
| HS Code | 2903799090 |
|---|
|
~%
1,4-Dibromo-2,3... CAS#:375-42-8 |
| Literature: Haszeldine Journal of the Chemical Society, 1952 , p. 4423,4429 |
|
~%
1,4-Dibromo-2,3... CAS#:375-42-8 |
| Literature: Dedek, V.; Chvatal, Z. Journal of Fluorine Chemistry, 1986 , vol. 31, p. 363 - 380 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Butane,1,4-dibromo-2,3-dichloro-1,1,2,3,4,4-hexafluoro |
| 1,4-dibromo-2,3-dichloro-1,1,2,3,4,4-hexafluoro-butane |
| 1,4-Dibromo-2,3-dichlorohexafluorobutane |
| 1,4-Dibrom-2,3-dichlor-1,1,2,3,4,4-hexafluor-butan |