4-(2-Chloro-acetylamino)-benzamide
Modify Date: 2025-09-01 16:38:36
4-(2-Chloro-acetylamino)-benzamide structure
|
Common Name | 4-(2-Chloro-acetylamino)-benzamide | ||
|---|---|---|---|---|
| CAS Number | 85126-67-6 | Molecular Weight | 212.63300 | |
| Density | 1.393g/cm3 | Boiling Point | 476ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.7ºC | |
| Name | 4-[(2-chloroacetyl)amino]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 476ºC at 760 mmHg |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.63300 |
| Flash Point | 241.7ºC |
| Exact Mass | 212.03500 |
| PSA | 72.19000 |
| LogP | 1.73610 |
| Index of Refraction | 1.63 |
| InChIKey | AHXTYKMJPLXNOS-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(NC(=O)CCl)cc1 |
| HS Code | 2924299090 |
|---|
|
~62%
4-(2-Chloro-ace... CAS#:85126-67-6 |
| Literature: Harte, Andrew J.; Gunnlaugsson, Thorfinnur Tetrahedron Letters, 2006 , vol. 47, # 35 p. 6321 - 6324 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(2-Chlor-acetylamino)-benzoesaeure-amid |
| 4-(2-chloro-acetylamino)-benzoic acid amide |
| 4-(2-chloroacetamido)benzamide |
| 4-(2-chloro-acetylamino)-benzamide |
| 4-Chloracetamino-benzamid |
| p-(2-Chloracetylamino)-benzamid |
| 4-[(chloroacetyl)amino]benzamide |