(-)-IPC2B(ALLYL), 1M IN PENTANE structure
|
Common Name | (-)-IPC2B(ALLYL), 1M IN PENTANE | ||
|---|---|---|---|---|
| CAS Number | 85116-38-7 | Molecular Weight | 326.36700 | |
| Density | 0.638 g/mL at 25ºC | Boiling Point | 35-36ºC | |
| Molecular Formula | C23H39B | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -49ºC | |
| Name | prop-2-enyl-bis[(1R,3R,4S,5R)-4,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]borane |
|---|
| Density | 0.638 g/mL at 25ºC |
|---|---|
| Boiling Point | 35-36ºC |
| Molecular Formula | C23H39B |
| Molecular Weight | 326.36700 |
| Flash Point | -49ºC |
| Exact Mass | 326.31400 |
| LogP | 6.81180 |
| Index of Refraction | 1.496 |
| InChIKey | ZIXZBDJFGUIKJS-RLEROFIGSA-N |
| SMILES | C=CCB(C1CC2CC(C1C)C2(C)C)C1CC2CC(C1C)C2(C)C |
| Hazard Codes | F+,Xn,N,F |
|---|---|
| RIDADR | UN 1265 3/PG 2 |
| HS Code | 2931900090 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |