1-chloro-5-fluoro-4-isocyanato-2-propan-2-yloxybenzene
Modify Date: 2025-10-17 05:48:43
1-chloro-5-fluoro-4-isocyanato-2-propan-2-yloxybenzene structure
|
Common Name | 1-chloro-5-fluoro-4-isocyanato-2-propan-2-yloxybenzene | ||
|---|---|---|---|---|
| CAS Number | 85113-29-7 | Molecular Weight | 229.63500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9ClFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-5-fluoro-4-isocyanato-2-propan-2-yloxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9ClFNO2 |
|---|---|
| Molecular Weight | 229.63500 |
| Exact Mass | 229.03100 |
| PSA | 38.66000 |
| LogP | 3.23360 |
| InChIKey | PZPMUYOAILKKIF-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1cc(N=C=O)c(F)cc1Cl |
|
~%
1-chloro-5-fluo... CAS#:85113-29-7 |
| Literature: Sumitomo Chemical Company, Limited Patent: US4437877 A1, 1984 ; |
|
~%
1-chloro-5-fluo... CAS#:85113-29-7 |
| Literature: Sumitomo Chemical Company, Limited Patent: US4427438 A1, 1984 ; |
|
~%
1-chloro-5-fluo... CAS#:85113-29-7 |
| Literature: Zhu, You-Quan; Wu, Chao; Li, Hua-Bin; Zou, Xiao-Mao; Si, Xue-Kai; Hu, Fang-Zhong; Yang, Hua-Zheng Journal of Agricultural and Food Chemistry, 2007 , vol. 55, # 4 p. 1364 - 1369 |
| Benzene,1-chloro-5-fluoro-4-isocyanato-2-(1-methylethoxy) |
| 2-fluoro-4-chloro-5-isopropyloxy-phenylisocyanate |
| 2-fluoro-4-chloro-5-isopropoxyphenyl isocyanate |
| 4-chloro-2-fluoro-5-isopropyloxyphenyl isocyanate |
| 4-chloro-2-fluoro-5-isopropoxyphenyl isocyanate |