2-(ethylnitroamino)ethyl nitrate structure
|
Common Name | 2-(ethylnitroamino)ethyl nitrate | ||
|---|---|---|---|---|
| CAS Number | 85068-73-1 | Molecular Weight | 179.13100 | |
| Density | 1.339g/cm3 | Boiling Point | 327.8ºC at 760 mmHg | |
| Molecular Formula | C4H9N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.1ºC | |
| Name | 2-[ethyl(nitro)amino]ethyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 327.8ºC at 760 mmHg |
| Molecular Formula | C4H9N3O5 |
| Molecular Weight | 179.13100 |
| Flash Point | 152.1ºC |
| Exact Mass | 179.05400 |
| PSA | 104.11000 |
| LogP | 0.75470 |
| Index of Refraction | 1.481 |
| InChIKey | JOPZHCIUTNIPAH-UHFFFAOYSA-N |
| SMILES | CCN(CCO[N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2922199090 |
|---|
|
~%
2-(ethylnitroam... CAS#:85068-73-1 |
| Literature: Blomquist; Fiedorek Patent: US2485855 , 1944 ; Full Text Show Details Blomquist; Fiedorek Patent: US2678946 , 1944 ; |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Aethyl-nitro-(2-nitryloxy-aethyl)-amin |
| ethyl-nitro-(2-nitryloxy-ethyl)-amine |
| N-Ethyl-2-nitratoethyl nitramine |
| 2-(Ethylnitroamino)ethanol nitrate (ester) |
| EINECS 285-332-6 |
| 2-(Ethylnitroamino)ethyl nitrate |
| Ethanol,2-(ethylnitroamino)-,nitrate (ester) |
| 1-(Aethyl-nitro-amino)-2-nitryloxy-aethan |