2-[bis(2-nitrooxyethyl)amino]ethyl nitrate
Modify Date: 2025-08-25 12:32:00
![2-[bis(2-nitrooxyethyl)amino]ethyl nitrate Structure](https://image.chemsrc.com/caspic/209/7077-34-1.png)
2-[bis(2-nitrooxyethyl)amino]ethyl nitrate structure
|
Common Name | 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate | ||
|---|---|---|---|---|
| CAS Number | 7077-34-1 | Molecular Weight | 284.18100 | |
| Density | 1.478 g/cm3 | Boiling Point | 381.8ºC at 760 mmHg | |
| Molecular Formula | C6H12N4O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.7ºC | |
| Name | 2-[bis(2-nitrooxyethyl)amino]ethyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.478 g/cm3 |
|---|---|
| Boiling Point | 381.8ºC at 760 mmHg |
| Molecular Formula | C6H12N4O9 |
| Molecular Weight | 284.18100 |
| Flash Point | 184.7ºC |
| Exact Mass | 284.06000 |
| PSA | 168.39000 |
| LogP | 0.48290 |
| Index of Refraction | 1.503 |
| InChIKey | HWKQNAWCHQMZHK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-] |
| Hazard Class | 1.1A |
|---|
|
~%
2-[bis(2-nitroo... CAS#:7077-34-1 |
| Literature: Dunn et al. Journal of the American Chemical Society, 1952 , vol. 74, p. 1344 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Trolnitratum [INN-Latin] |
| Trolnitrate |
| 2,2',2''-Nitrilotriethylnitrat |
| Trolnitrate [INN] |
| 2,2',2''-Nitrilotriethanol trinitrate |
| tris-(2-nitryloxy-ethyl)-amine |
| Triethanolaminotrisalpetersaeureester |
| Triethanolamintrinitrat |
| 2,2',2''-Nitrilotrisethanol,trinitrate (ester) |
| Trolnitrato [INN-Spanish] |
| EINECS 230-376-3 |
| Tris-(2-nitryloxy-aethyl)-amin |