2-[2-[bis(2-nitrooxyethyl)amino]ethyl-(2-nitrooxyethyl)amino]ethyl nitrate
Modify Date: 2025-09-11 10:28:29
![2-[2-[bis(2-nitrooxyethyl)amino]ethyl-(2-nitrooxyethyl)amino]ethyl nitrate Structure](https://image.chemsrc.com/caspic/140/21946-79-2.png)
2-[2-[bis(2-nitrooxyethyl)amino]ethyl-(2-nitrooxyethyl)amino]ethyl nitrate structure
|
Common Name | 2-[2-[bis(2-nitrooxyethyl)amino]ethyl-(2-nitrooxyethyl)amino]ethyl nitrate | ||
|---|---|---|---|---|
| CAS Number | 21946-79-2 | Molecular Weight | 416.29900 | |
| Density | 1.462g/cm3 | Boiling Point | 509.5ºC at 760 mmHg | |
| Molecular Formula | C10H20N6O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262ºC | |
| Name | 2-[2-[bis(2-nitrooxyethyl)amino]ethyl-(2-nitrooxyethyl)amino]ethyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.462g/cm3 |
|---|---|
| Boiling Point | 509.5ºC at 760 mmHg |
| Molecular Formula | C10H20N6O12 |
| Molecular Weight | 416.29900 |
| Flash Point | 262ºC |
| Exact Mass | 416.11400 |
| PSA | 226.68000 |
| LogP | 0.51640 |
| Vapour Pressure | 1.68E-10mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | DLDKCSIJFIPYRK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCCN(CCO[N+](=O)[O-])CCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-] |
| HS Code | 2921290000 |
|---|
| HS Code | 2921290000 |
|---|---|
| Summary | 2921290000 other acyclic polyamines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethanol,2,2',2'',2'''-(1,2-ethanediyldinitrilo)tetrakis-,tetranitrate(ester) |
| N,N,N',N'-Tetrakis(2-hydroxyethyl)ethylenediaminetetranitrate |
| Tenitramine |
| UNII-CKB16BAQ3S |