2-chloro-3-(trifluoromethyl)benzoyl chloride structure
|
Common Name | 2-chloro-3-(trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 850156-39-7 | Molecular Weight | 243.01000 | |
| Density | 1.506g/cm3 | Boiling Point | 231.3ºC at 760 mmHg | |
| Molecular Formula | C8H3Cl2F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.7ºC | |
| Name | 2-chloro-3-(trifluoromethyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 231.3ºC at 760 mmHg |
| Molecular Formula | C8H3Cl2F3O |
| Molecular Weight | 243.01000 |
| Flash Point | 93.7ºC |
| Exact Mass | 241.95100 |
| PSA | 17.07000 |
| LogP | 3.73780 |
| Index of Refraction | 1.486 |
| InChIKey | PKEMXTIVOBWBNO-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cccc(C(F)(F)F)c1Cl |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2916399090 |
|
~%
2-chloro-3-(tri... CAS#:850156-39-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 49, # 12 p. 3659 - 3666 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| ZLD0242 |
| 2-chloro-3-trifluoromethylbenzoyl chloride |
| JRD-1285 |
| 2-chloro-3-trifluoromethylbenzoic acid chloride |