chlorfenac structure
|
Common Name | chlorfenac | ||
|---|---|---|---|---|
| CAS Number | 85-34-7 | Molecular Weight | 239.48300 | |
| Density | 1.568 | Boiling Point | 353.5ºC at 760 mmHg | |
| Molecular Formula | C8H5Cl3O2 | Melting Point | 161ºC | |
| MSDS | Chinese USA | Flash Point | 167.6ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | chlorfenac |
|---|---|
| Synonym | More Synonyms |
| Density | 1.568 |
|---|---|
| Boiling Point | 353.5ºC at 760 mmHg |
| Melting Point | 161ºC |
| Molecular Formula | C8H5Cl3O2 |
| Molecular Weight | 239.48300 |
| Flash Point | 167.6ºC |
| Exact Mass | 237.93600 |
| PSA | 37.30000 |
| LogP | 3.27390 |
| Index of Refraction | 1.4521 (estimate) |
| InChIKey | QZXCCPZJCKEPSA-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1c(Cl)ccc(Cl)c1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H411 |
| Precautionary Statements | P273 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | N: Dangerous for the environment;Xn: Harmful; |
| Risk Phrases | R51/53 |
| Safety Phrases | S36;S61 |
| RIDADR | UN 3077 |
| RTECS | AJ8750000 |
| HS Code | 2916399017 |
|
~%
chlorfenac CAS#:85-34-7 |
| Literature: Phytochemistry (Elsevier), , vol. 27, # l p. 51 - 72 |
|
~%
chlorfenac CAS#:85-34-7 |
| Literature: Annals of Applied Biology, , vol. 47, p. 593,595 |
|
~%
chlorfenac CAS#:85-34-7 |
| Literature: Phytochemistry (Elsevier), , vol. 27, # l p. 51 - 72 |
| HS Code | 2916399017 |
|---|---|
| Summary | 2916399017 2-(2,3,6-trichlorophenyl)acetic acid。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
2,3,6-Trichlorophenylacetic acid (fenac) degradation in aqueous and soil systems.
Bull. Environ. Contam. Toxicol. 32(4) , 383-90, (1984)
|
| 2,3,6-trichlorobenzenacetic acid |
| Kanepar |
| EINECS 201-599-3 |
| TCPA |
| Trifene |
| Chlorfenac |
| 2-(2,3,6-trichlorophenyl)acetic acid |
| MFCD00014367 |
| (2,3,6-trichlorophenyl)acetic acid |
| 2,3,6-trichlorobenzeneacetic acid |
| Benzeneacetic acid,2,3,6-trichloro |
| Fenae |
| Tri-fen |
| fenac |