5-Chloro-2-hydroxybenzophenone structure
|
Common Name | 5-Chloro-2-hydroxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 85-19-8 | Molecular Weight | 232.66200 | |
| Density | 1.307 g/cm3 | Boiling Point | 355.5ºC(lit.) | |
| Molecular Formula | C13H9ClO2 | Melting Point | 96-98 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 168.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (5-chloro-2-hydroxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.307 g/cm3 |
|---|---|
| Boiling Point | 355.5ºC(lit.) |
| Melting Point | 96-98 °C(lit.) |
| Molecular Formula | C13H9ClO2 |
| Molecular Weight | 232.66200 |
| Flash Point | 168.8ºC |
| Exact Mass | 232.02900 |
| PSA | 37.30000 |
| LogP | 3.27660 |
| Index of Refraction | 1.623 |
| InChIKey | OMWSZDODENFLSV-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cc(Cl)ccc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Benzophenone-7 |
| 2-Hydroxy-5-chlorobenzophenone |
| 3-Chloro-6-hydroxybenzophenone |
| 5-chloro-2-hydroxybenzophenone |
| UV Absorber nl/5 |
| Benzophenone,5-chloro-2-hydroxy |
| EINECS 201-592-5 |
| 2-benzoyl-4-chlorophenol |
| Dow Hcb |
| o-benzoyl-p-chlorophenol |
| MFCD00020134 |